C26H30IrNO3- — CID 153460572
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-(phenoxy)isoquinoline (PubChem CID 153460572) has the molecular formula C26H30IrNO3- and a molecular weight of 596.75 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-(phenoxy)isoquinoline.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-(phenoxy)isoquinoline |
|---|---|
| PubChem CID | 153460572 |
| Molecular Formula | C26H30IrNO3- |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-(phenoxy)isoquinoline |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1ccccc1Oc1cc2ccccc2cn1 |
| InChI | InChI=1S/C15H10NO.C11H20O2.Ir/c1-2-8-14(9-3-1)17-15-10-12-6-4-5-7-13(12)11-16-15;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-8,10-11H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | LQPZVXHNYOWCFC-HXIBTQJOSA-N |
| XLogP | 6.91 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|