C28H36IrNO3Se- — CID 153460911
(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;5-(phenoxy)selenopheno[2,3-c]pyridine (PubChem CID 153460911) has the molecular formula C28H36IrNO3Se- and a molecular weight of 705.78 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;5-(phenoxy)selenopheno[2,3-c]pyridine.
| Compound Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;5-(phenoxy)selenopheno[2,3-c]pyridine |
|---|---|
| PubChem CID | 153460911 |
| Molecular Formula | C28H36IrNO3Se- |
| Molecular Weight | 705.78 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;5-(phenoxy)selenopheno[2,3-c]pyridine |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir].[c-]1ccccc1Oc1cc2cc[se]c2cn1 |
| InChI | InChI=1S/C15H28O2.C13H8NOSe.Ir/c1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;1-2-4-11(5-3-1)15-13-8-10-6-7-16-12(10)9-14-13;/h11,16H,7-10H2,1-6H3;1-4,6-9H;/q;-1;/b12-11-;; |
| InChIKey | NKQSAEKKTGRAMZ-IPEZHVIRSA-N |
| XLogP | 7.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|