C36H38IrNO2SSe- — CID 164815508
CID 164815508 (PubChem CID 164815508) has the molecular formula C36H38IrNO2SSe- and a molecular weight of 819.95 g/mol.
| Compound Name | CID 164815508 |
|---|---|
| PubChem CID | 164815508 |
| Molecular Formula | C36H38IrNO2SSe- |
| Molecular Weight | 819.95 g/mol |
| Exact Mass | 821.14 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir].[c-]1ccc2sc3cccc4[se]c5cc6ccccc6nc5c1c2c34 |
| InChI | InChI=1S/C21H10NSSe.C15H28O2.Ir/c1-2-7-14-12(5-1)11-18-21(22-14)13-6-3-8-15-19(13)20-16(23-15)9-4-10-17(20)24-18;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h1-5,7-11H;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | NYSSFAUYDSFEID-SWPBDETKSA-N |
| XLogP | 10.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.95 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|