About CID 164814291
CID 164814291 (PubChem CID 164814291) has the molecular formula C32H30IrNO3Se-
and a molecular weight of 747.77 g/mol.
Molecular Properties
| Compound Name | CID 164814291 |
| PubChem CID | 164814291 |
| Molecular Formula | C32H30IrNO3Se- |
| Molecular Weight | 747.77 g/mol |
| Exact Mass | 749.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1ccc2oc3cccc4[se]c5cc6ccccc6nc5c1c2c34 |
| InChI | InChI=1S/C21H10NOSe.C11H20O2.Ir/c1-2-7-14-12(5-1)11-18-21(22-14)13-6-3-8-15-19(13)20-16(23-15)9-4-10-17(20)24-18;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-5,7-11H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | IMQZAUTUSPENDT-HXIBTQJOSA-N |
| XLogP | 8.38 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 747.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164814291 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164814291?
The IUPAC name of CID 164814291 (CID 164814291) is not available.
What is the SMILES notation for CID 164814291?
The canonical SMILES for CID 164814291 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1ccc2oc3cccc4[se]c5cc6ccccc6nc5c1c2c34.
What is the InChIKey of CID 164814291?
The InChIKey is IMQZAUTUSPENDT-HXIBTQJOSA-N. The full InChI is InChI=1S/C21H10NOSe.C11H20O2.Ir/c1-2-7-14-12(5-1)11-18-21(22-14)13-6-3-8-15-19(13)20-16(23-15)9-4-10-17(20)24-18;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-5,7-11H;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 164814291?
CID 164814291 has a molecular weight of 747.77 g/mol, XLogP of 8.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164814291 is sourced from PubChem (CID 164814291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).