C40H44IrNO3- — CID 168815656
2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-propan-2-ylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 168815656) has the molecular formula C40H44IrNO3- and a molecular weight of 779.01 g/mol. Its IUPAC name is 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-propan-2-ylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-propan-2-ylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 168815656 |
| Molecular Formula | C40H44IrNO3- |
| Molecular Weight | 779.01 g/mol |
| Exact Mass | 779.30 |
| IUPAC Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-propan-2-ylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC(C)c1ccc2nc(-c3[c-]ccc4c3C(C)(C)c3c-4oc4ccccc34)ccc2c1.[Ir] |
| InChI | InChI=1S/C29H24NO.C11H20O2.Ir/c1-17(2)18-12-14-23-19(16-18)13-15-24(30-23)20-9-7-10-22-26(20)29(3,4)27-21-8-5-6-11-25(21)31-28(22)27;1-10(2,3)8(12)7-9(13)11(4,5)6;/h5-8,10-17H,1-4H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | NPXBJPLDDKSQIL-HXIBTQJOSA-N |
| XLogP | 10.96 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.01 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|