C34H32IrN2O2-2 — CID 168815344
2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide (PubChem CID 168815344) has the molecular formula C34H32IrN2O2-2 and a molecular weight of 692.86 g/mol. Its IUPAC name is 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide.
| Compound Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide |
|---|---|
| PubChem CID | 168815344 |
| Molecular Formula | C34H32IrN2O2-2 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide |
| SMILES | CC(=O)/C=C(/C)[N-]C(C)C.CC1(C)c2c(-c3ccc4ccccc4n3)[c-]ccc2-c2oc3ccccc3c21.[Ir] |
| InChI | InChI=1S/C26H18NO.C8H15NO.Ir/c1-26(2)23-17(21-15-14-16-8-3-5-12-20(16)27-21)10-7-11-19(23)25-24(26)18-9-4-6-13-22(18)28-25;1-6(2)9-7(3)5-8(4)10;/h3-9,11-15H,1-2H3;5-6H,1-4H3,(H,9,10);/q-1;;/p-1 |
| InChIKey | RLLDEMWXWPDZGH-UHFFFAOYSA-M |
| XLogP | 9.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|