C40H47IrN3O-2 — CID 168815338
[C,N-di(propan-2-yl)carbonimidoyl]-propan-2-ylazanide;iridium;4,5,7-trimethyl-2-(8,10,10-trimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline (PubChem CID 168815338) has the molecular formula C40H47IrN3O-2 and a molecular weight of 778.05 g/mol. Its IUPAC name is [C,N-di(propan-2-yl)carbonimidoyl]-propan-2-ylazanide;iridium;4,5,7-trimethyl-2-(8,10,10-trimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline.
| Compound Name | [C,N-di(propan-2-yl)carbonimidoyl]-propan-2-ylazanide;iridium;4,5,7-trimethyl-2-(8,10,10-trimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline |
|---|---|
| PubChem CID | 168815338 |
| Molecular Formula | C40H47IrN3O-2 |
| Molecular Weight | 778.05 g/mol |
| Exact Mass | 778.34 |
| IUPAC Name | [C,N-di(propan-2-yl)carbonimidoyl]-propan-2-ylazanide;iridium;4,5,7-trimethyl-2-(8,10,10-trimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)quinoline |
| SMILES | CC(C)/N=C(/[N-]C(C)C)C(C)C.Cc1cc(C)c2c(C)cc(-c3[c-]ccc4c3C(C)(C)c3c-4oc4ccc(C)cc34)nc2c1.[Ir] |
| InChI | InChI=1S/C30H26NO.C10H21N2.Ir/c1-16-10-11-25-22(13-16)28-29(32-25)21-9-7-8-20(27(21)30(28,5)6)23-15-19(4)26-18(3)12-17(2)14-24(26)31-23;1-7(2)10(11-8(3)4)12-9(5)6;/h7,9-15H,1-6H3;7-9H,1-6H3;/q2*-1; |
| InChIKey | GGORGJJVOHMYML-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.05 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|