C48H58IrN2O2-2 — CID 168815726
cyclohexyl-[(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-4,5,7-trimethylquinoline;iridium (PubChem CID 168815726) has the molecular formula C48H58IrN2O2-2 and a molecular weight of 887.22 g/mol. Its IUPAC name is cyclohexyl-[(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-4,5,7-trimethylquinoline;iridium.
| Compound Name | cyclohexyl-[(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-4,5,7-trimethylquinoline;iridium |
|---|---|
| PubChem CID | 168815726 |
| Molecular Formula | C48H58IrN2O2-2 |
| Molecular Weight | 887.22 g/mol |
| Exact Mass | 887.41 |
| IUPAC Name | cyclohexyl-[(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-4,5,7-trimethylquinoline;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\[N-]C1CCCCC1)C(CC)CC.Cc1cc(C)c2c(C)cc(-c3[c-]ccc4c3C(C)(C)c3c-4oc4ccccc34)nc2c1.[Ir] |
| InChI | InChI=1S/C29H24NO.C19H35NO.Ir/c1-16-13-17(2)25-18(3)15-22(30-23(25)14-16)19-10-8-11-21-26(19)29(4,5)27-20-9-6-7-12-24(20)31-28(21)27;1-5-15(6-2)18(14-19(21)16(7-3)8-4)20-17-12-10-9-11-13-17;/h6-9,11-15H,1-5H3;14-17H,5-13H2,1-4H3,(H,20,21);/q-1;;/p-1 |
| InChIKey | RRTOSFSIWOMLQI-UHFFFAOYSA-M |
| XLogP | 13.70 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.22 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|