C34H32IrNO2S- — CID 168815621
2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-4,5,7-trimethylquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 168815621) has the molecular formula C34H32IrNO2S- and a molecular weight of 710.92 g/mol. Its IUPAC name is 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-4,5,7-trimethylquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-4,5,7-trimethylquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 168815621 |
| Molecular Formula | C34H32IrNO2S- |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-4,5,7-trimethylquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C)c2c(C)cc(-c3[c-]ccc4c3C(C)(C)c3c-4sc4ccccc34)nc2c1.[Ir] |
| InChI | InChI=1S/C29H24NS.C5H8O2.Ir/c1-16-13-17(2)25-18(3)15-22(30-23(25)14-16)19-10-8-11-21-26(19)29(4,5)27-20-9-6-7-12-24(20)31-28(21)27;1-4(6)3-5(2)7;/h6-9,11-15H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DIXUVEGISPNOGV-LWFKIUJUSA-N |
| XLogP | 9.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|