C39H42IrNO2S- — CID 168815640
2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 168815640) has the molecular formula C39H42IrNO2S- and a molecular weight of 781.05 g/mol. Its IUPAC name is 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 168815640 |
| Molecular Formula | C39H42IrNO2S- |
| Molecular Weight | 781.05 g/mol |
| Exact Mass | 781.26 |
| IUPAC Name | 2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzothiol-2-id-1-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc(C)c2ccc(-c3[c-]ccc4c3C(C)(C)c3c-4sc4ccccc34)nc2c1.[Ir] |
| InChI | InChI=1S/C28H22NS.C11H20O2.Ir/c1-16-14-17(2)18-12-13-22(29-23(18)15-16)19-9-7-10-21-25(19)28(3,4)26-20-8-5-6-11-24(20)30-27(21)26;1-10(2,3)8(12)7-9(13)11(4,5)6;/h5-8,10-15H,1-4H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | HVJMDSAPCAWMMJ-HXIBTQJOSA-N |
| XLogP | 10.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.05 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|