C46H55IrN3O-2 — CID 168815160
cyclohexyl-(N-cyclohexyl-C-propan-2-ylcarbonimidoyl)azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-(2-methylpropyl)quinoline;iridium (PubChem CID 168815160) has the molecular formula C46H55IrN3O-2 and a molecular weight of 858.18 g/mol. Its IUPAC name is cyclohexyl-(N-cyclohexyl-C-propan-2-ylcarbonimidoyl)azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-(2-methylpropyl)quinoline;iridium.
| Compound Name | cyclohexyl-(N-cyclohexyl-C-propan-2-ylcarbonimidoyl)azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-(2-methylpropyl)quinoline;iridium |
|---|---|
| PubChem CID | 168815160 |
| Molecular Formula | C46H55IrN3O-2 |
| Molecular Weight | 858.18 g/mol |
| Exact Mass | 858.40 |
| IUPAC Name | cyclohexyl-(N-cyclohexyl-C-propan-2-ylcarbonimidoyl)azanide;2-(10,10-dimethyl-2H-indeno[1,2-b][1]benzofuran-2-id-1-yl)-6-(2-methylpropyl)quinoline;iridium |
| SMILES | CC(C)/C(=N\C1CCCCC1)[N-]C1CCCCC1.CC(C)Cc1ccc2nc(-c3[c-]ccc4c3C(C)(C)c3c-4oc4ccccc34)ccc2c1.[Ir] |
| InChI | InChI=1S/C30H26NO.C16H29N2.Ir/c1-18(2)16-19-12-14-24-20(17-19)13-15-25(31-24)21-9-7-10-23-27(21)30(3,4)28-22-8-5-6-11-26(22)32-29(23)28;1-13(2)16(17-14-9-5-3-6-10-14)18-15-11-7-4-8-12-15;/h5-8,10-15,17-18H,16H2,1-4H3;13-15H,3-12H2,1-2H3;/q2*-1; |
| InChIKey | JHQCTARASJQVGM-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.18 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|