C26H21IrN2O2S- — CID 176651640
(Z)-4-hydroxypent-3-en-2-one;iridium;4-methyl-6-quinolin-2-yl-7H-[1]benzothiolo[3,2-c]pyridin-7-ide (PubChem CID 176651640) has the molecular formula C26H21IrN2O2S- and a molecular weight of 617.75 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-methyl-6-quinolin-2-yl-7H-[1]benzothiolo[3,2-c]pyridin-7-ide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methyl-6-quinolin-2-yl-7H-[1]benzothiolo[3,2-c]pyridin-7-ide |
|---|---|
| PubChem CID | 176651640 |
| Molecular Formula | C26H21IrN2O2S- |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methyl-6-quinolin-2-yl-7H-[1]benzothiolo[3,2-c]pyridin-7-ide |
| SMILES | CC(=O)/C=C(/C)O.Cc1cncc2c1sc1c(-c3ccc4ccccc4n3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C21H13N2S.C5H8O2.Ir/c1-13-11-22-12-17-15-6-4-7-16(21(15)24-20(13)17)19-10-9-14-5-2-3-8-18(14)23-19;1-4(6)3-5(2)7;/h2-6,8-12H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | ONIXWMVRSQJWFS-LWFKIUJUSA-N |
| XLogP | 6.81 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|