C29H34IrNO2- — CID 157230026
2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)quinoline;4-hydroxypent-3-en-2-one;iridium (PubChem CID 157230026) has the molecular formula C29H34IrNO2- and a molecular weight of 620.81 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)quinoline;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)quinoline;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 157230026 |
| Molecular Formula | C29H34IrNO2- |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)quinoline;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.CC1(C)c2c[c-]c(-c3ccc4ccccc4n3)cc2C(C)(C)C1(C)C.[Ir] |
| InChI | InChI=1S/C24H26N.C5H8O2.Ir/c1-22(2)18-13-11-17(15-19(18)23(3,4)24(22,5)6)21-14-12-16-9-7-8-10-20(16)25-21;1-4(6)3-5(2)7;/h7-10,12-15H,1-6H3;3,6H,1-2H3;/q-1;; |
| InChIKey | BBBIMBAQVQOQML-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|