C41H37IrN4- — CID 140826744
2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;iridium (PubChem CID 140826744) has the molecular formula C41H37IrN4- and a molecular weight of 777.99 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;iridium.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 140826744 |
| Molecular Formula | C41H37IrN4- |
| Molecular Weight | 777.99 g/mol |
| Exact Mass | 778.27 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;iridium |
| SMILES | CC1(C)c2c[c-]c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cn3)cc2C(C)(C)C1(C)C.[Ir] |
| InChI | InChI=1S/C41H37N4.Ir/c1-39(2)33-23-21-31(25-34(33)40(3,4)41(39,5)6)35-24-22-32(26-42-35)38-44-36(29-15-11-8-12-16-29)43-37(45-38)30-19-17-28(18-20-30)27-13-9-7-10-14-27;/h7-20,22-26H,1-6H3;/q-1; |
| InChIKey | SLIHISUVHZJFPH-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.99 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|