C48H41IrN4- — CID 147979171
2-(9H-fluoren-1-yl)-4-[4-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]phenyl]-6-phenyl-1,3,5-triazine;iridium (PubChem CID 147979171) has the molecular formula C48H41IrN4- and a molecular weight of 866.10 g/mol. Its IUPAC name is 2-(9H-fluoren-1-yl)-4-[4-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]phenyl]-6-phenyl-1,3,5-triazine;iridium.
| Compound Name | 2-(9H-fluoren-1-yl)-4-[4-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]phenyl]-6-phenyl-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 147979171 |
| Molecular Formula | C48H41IrN4- |
| Molecular Weight | 866.10 g/mol |
| Exact Mass | 866.30 |
| IUPAC Name | 2-(9H-fluoren-1-yl)-4-[4-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]phenyl]-6-phenyl-1,3,5-triazine;iridium |
| SMILES | CC1(C)c2c[c-]c(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc7c6Cc6ccccc6-7)n5)cc4)cn3)cc2C(C)(C)C1(C)C.[Ir] |
| InChI | InChI=1S/C48H41N4.Ir/c1-46(2)40-25-23-34(28-41(40)47(3,4)48(46,5)6)42-26-24-35(29-49-42)30-19-21-32(22-20-30)44-50-43(31-13-8-7-9-14-31)51-45(52-44)38-18-12-17-37-36-16-11-10-15-33(36)27-39(37)38;/h7-22,24-26,28-29H,27H2,1-6H3;/q-1; |
| InChIKey | BOUYXOPZSKTXKM-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.10 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|