C31H32IrN3- — CID 140826608
2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-methyl-6-phenylpyrimidine;iridium (PubChem CID 140826608) has the molecular formula C31H32IrN3- and a molecular weight of 638.84 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-methyl-6-phenylpyrimidine;iridium.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-methyl-6-phenylpyrimidine;iridium |
|---|---|
| PubChem CID | 140826608 |
| Molecular Formula | C31H32IrN3- |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]-4-methyl-6-phenylpyrimidine;iridium |
| SMILES | Cc1cc(-c2ccccc2)nc(-c2ccc(-c3[c-]cc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1.[Ir] |
| InChI | InChI=1S/C31H32N3.Ir/c1-20-17-27(21-11-9-8-10-12-21)34-28(33-20)23-14-16-26(32-19-23)22-13-15-24-25(18-22)30(4,5)31(6,7)29(24,2)3;/h8-12,14-19H,1-7H3;/q-1; |
| InChIKey | MWDZFEVPZIYSHX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|