C36H36N4 — CID 118857536
2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 118857536) has the molecular formula C36H36N4 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118857536 |
| Molecular Formula | C36H36N4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | Cc1ccccc1-c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1 |
| InChI | InChI=1S/C36H36N4/c1-23-13-11-12-16-27(23)33-39-31(24-14-9-8-10-15-24)38-32(40-33)26-18-20-30(37-22-26)25-17-19-28-29(21-25)35(4,5)36(6,7)34(28,2)3/h8-22H,1-7H3 |
| InChIKey | NBQBHCQUQZNIKA-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |