C26H25N5 — CID 118857250
2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine-4,6-dicarbonitrile (PubChem CID 118857250) has the molecular formula C26H25N5 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine-4,6-dicarbonitrile.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 118857250 |
| Molecular Formula | C26H25N5 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine-4,6-dicarbonitrile |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4nc(C#N)cc(C#N)n4)cn3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C26H25N5/c1-24(2)20-9-7-16(11-21(20)25(3,4)26(24,5)6)22-10-8-17(15-29-22)23-30-18(13-27)12-19(14-28)31-23/h7-12,15H,1-6H3 |
| InChIKey | DZQGVZZGIPDNDC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |