C33H42ClN3 — CID 122487885
2-chloro-4,6-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1,3,5-triazine (PubChem CID 122487885) has the molecular formula C33H42ClN3 and a molecular weight of 516.17 g/mol. Its IUPAC name is 2-chloro-4,6-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 122487885 |
| Molecular Formula | C33H42ClN3 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 2-chloro-4,6-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3nc(Cl)nc(-c4ccc5c(c4)C(C)(C)C(C)(C)C5(C)C)n3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C33H42ClN3/c1-28(2)21-15-13-19(17-23(21)30(5,6)32(28,9)10)25-35-26(37-27(34)36-25)20-14-16-22-24(18-20)31(7,8)33(11,12)29(22,3)4/h13-18H,1-12H3 |
| InChIKey | ICKUQIWFMXBIEY-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |