C21H27N — CID 154982020
2-(1,1,2,2,3,3-hexamethylinden-5-yl)aniline (PubChem CID 154982020) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexamethylinden-5-yl)aniline.
| Compound Name | 2-(1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
|---|---|
| PubChem CID | 154982020 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
| SMILES | CC1(C)c2ccc(-c3ccccc3N)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C21H27N/c1-19(2)16-12-11-14(15-9-7-8-10-18(15)22)13-17(16)20(3,4)21(19,5)6/h7-13H,22H2,1-6H3 |
| InChIKey | VBAHNJMRIFAYGM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|