C34H37N — CID 142500857
3-(1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N,N-diphenylaniline (PubChem CID 142500857) has the molecular formula C34H37N and a molecular weight of 459.68 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N,N-diphenylaniline.
| Compound Name | 3-(1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142500857 |
| Molecular Formula | C34H37N |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 3-(1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N,N-diphenylaniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccccc2)cc1-c1ccc2c(c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C34H37N/c1-24-18-20-28(35(26-14-10-8-11-15-26)27-16-12-9-13-17-27)23-29(24)25-19-21-30-31(22-25)33(4,5)34(6,7)32(30,2)3/h8-23H,1-7H3 |
| InChIKey | FYULQROWJGERKA-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |