C50H60N2 — CID 142500399
1-N,4-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine (PubChem CID 142500399) has the molecular formula C50H60N2 and a molecular weight of 689.04 g/mol. Its IUPAC name is 1-N,4-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142500399 |
| Molecular Formula | C50H60N2 |
| Molecular Weight | 689.04 g/mol |
| Exact Mass | 688.48 |
| IUPAC Name | 1-N,4-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-1-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine |
| SMILES | Cc1ccc(N(c2ccc(N(c3ccc(C)cc3)c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)cc2)c2ccc3c(c2)C(C)(C)C(C)(C)C3(C)C)cc1 |
| InChI | InChI=1S/C50H60N2/c1-33-15-19-35(20-16-33)51(39-27-29-41-43(31-39)47(7,8)49(11,12)45(41,3)4)37-23-25-38(26-24-37)52(36-21-17-34(2)18-22-36)40-28-30-42-44(32-40)48(9,10)50(13,14)46(42,5)6/h15-32H,1-14H3 |
| InChIKey | IPNROSJLKOLTCT-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.04 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |