C30H29NO — CID 137436609
6-methoxy-9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine (PubChem CID 137436609) has the molecular formula C30H29NO and a molecular weight of 419.57 g/mol. Its IUPAC name is 6-methoxy-9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine.
| Compound Name | 6-methoxy-9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 137436609 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 6-methoxy-9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine |
| SMILES | COc1ccc2c(c1)-c1ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc1C2(C)C |
| InChI | InChI=1S/C30H29NO/c1-20-6-10-22(11-7-20)31(23-12-8-21(2)9-13-23)24-14-16-26-27-19-25(32-5)15-17-28(27)30(3,4)29(26)18-24/h6-19H,1-5H3 |
| InChIKey | VHMKSZGCOGERFZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |