C29H27N — CID 11111910
9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine (PubChem CID 11111910) has the molecular formula C29H27N and a molecular weight of 389.54 g/mol. Its IUPAC name is 9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 11111910 |
| Molecular Formula | C29H27N |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 9,9-dimethyl-N,N-bis(4-methylphenyl)fluoren-2-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C29H27N/c1-20-9-13-22(14-10-20)30(23-15-11-21(2)12-16-23)24-17-18-26-25-7-5-6-8-27(25)29(3,4)28(26)19-24/h5-19H,1-4H3 |
| InChIKey | DFQSBKNRMOWBLN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |