C46H41N — CID 163882146
N,N-bis(9,9-dimethylfluoren-3-yl)-7,9,9-trimethylfluoren-2-amine (PubChem CID 163882146) has the molecular formula C46H41N and a molecular weight of 607.84 g/mol. Its IUPAC name is N,N-bis(9,9-dimethylfluoren-3-yl)-7,9,9-trimethylfluoren-2-amine.
| Compound Name | N,N-bis(9,9-dimethylfluoren-3-yl)-7,9,9-trimethylfluoren-2-amine |
|---|---|
| PubChem CID | 163882146 |
| Molecular Formula | C46H41N |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | N,N-bis(9,9-dimethylfluoren-3-yl)-7,9,9-trimethylfluoren-2-amine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(N(c3ccc4c(c3)-c3ccccc3C4(C)C)c3ccc4c(c3)-c3ccccc3C4(C)C)ccc1-2 |
| InChI | InChI=1S/C46H41N/c1-28-16-20-34-35-21-17-31(27-43(35)46(6,7)42(34)24-28)47(29-18-22-40-36(25-29)32-12-8-10-14-38(32)44(40,2)3)30-19-23-41-37(26-30)33-13-9-11-15-39(33)45(41,4)5/h8-27H,1-7H3 |
| InChIKey | PUEHGNHINYZHFO-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |