C66H55N — CID 177067256
N-(3,5-dimethylphenyl)-2,7,10,10-tetramethyl-N-(2,7,7'-trimethyl-9,9'-spirobi[fluorene]-2'-yl)spiro[anthracene-9,9'-fluorene]-2'-amine (PubChem CID 177067256) has the molecular formula C66H55N and a molecular weight of 862.17 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2,7,10,10-tetramethyl-N-(2,7,7'-trimethyl-9,9'-spirobi[fluorene]-2'-yl)spiro[anthracene-9,9'-fluorene]-2'-amine.
| Compound Name | N-(3,5-dimethylphenyl)-2,7,10,10-tetramethyl-N-(2,7,7'-trimethyl-9,9'-spirobi[fluorene]-2'-yl)spiro[anthracene-9,9'-fluorene]-2'-amine |
|---|---|
| PubChem CID | 177067256 |
| Molecular Formula | C66H55N |
| Molecular Weight | 862.17 g/mol |
| Exact Mass | 861.43 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2,7,10,10-tetramethyl-N-(2,7,7'-trimethyl-9,9'-spirobi[fluorene]-2'-yl)spiro[anthracene-9,9'-fluorene]-2'-amine |
| SMILES | Cc1cc(C)cc(N(c2ccc3c(c2)C2(c4cc(C)ccc4-c4ccc(C)cc42)c2cc(C)ccc2-3)c2ccc3c(c2)C2(c4ccccc4-3)c3cc(C)ccc3C(C)(C)c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C66H55N/c1-38-14-21-49-50-22-15-39(2)32-58(50)66(57(49)31-38)59-33-40(3)16-23-51(59)53-25-20-46(37-61(53)66)67(47-29-43(6)28-44(7)30-47)45-19-24-52-48-12-10-11-13-54(48)65(60(52)36-45)62-34-41(4)17-26-55(62)64(8,9)56-27-18-42(5)35-63(56)65/h10-37H,1-9H3 |
| InChIKey | MUWJLEIXSOVLKF-UHFFFAOYSA-N |
| XLogP | 16.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.17 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |