C52H48N2 — CID 59800971
6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetrakis(4-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine (PubChem CID 59800971) has the molecular formula C52H48N2 and a molecular weight of 700.97 g/mol. Its IUPAC name is 6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetrakis(4-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine.
| Compound Name | 6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetrakis(4-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 59800971 |
| Molecular Formula | C52H48N2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | 6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetrakis(4-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)ccc2-4)cc1 |
| InChI | InChI=1S/C52H48N2/c1-33-9-17-37(18-10-33)53(38-19-11-34(2)12-20-38)41-25-27-43-45-31-50-46(32-49(45)51(5,6)47(43)29-41)44-28-26-42(30-48(44)52(50,7)8)54(39-21-13-35(3)14-22-39)40-23-15-36(4)16-24-40/h9-32H,1-8H3 |
| InChIKey | SFIHJSXZPFTEMP-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |