C67H56N4 — CID 138571645
2-N,2-N,2-N',2-N',7-N',7-N'-hexakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (PubChem CID 138571645) has the molecular formula C67H56N4 and a molecular weight of 917.21 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine.
| Compound Name | 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 138571645 |
| Molecular Formula | C67H56N4 |
| Molecular Weight | 917.21 g/mol |
| Exact Mass | 916.45 |
| IUPAC Name | 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C2(c4cc(N)ccc4-3)c3cc(N(c4ccc(C)cc4)c4ccc(C)cc4)ccc3-c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc32)cc1 |
| InChI | InChI=1S/C67H56N4/c1-43-7-20-50(21-8-43)69(51-22-9-44(2)10-23-51)56-32-36-60-59-35-19-49(68)39-63(59)67(64(60)40-56)65-41-57(70(52-24-11-45(3)12-25-52)53-26-13-46(4)14-27-53)33-37-61(65)62-38-34-58(42-66(62)67)71(54-28-15-47(5)16-29-54)55-30-17-48(6)18-31-55/h7-42H,68H2,1-6H3 |
| InChIKey | PUGYPKFFHGRZSU-UHFFFAOYSA-N |
| XLogP | 17.87 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.21 |
| LogP ≤ 5 | 17.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|