C34H38N4 — CID 142830870
4-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine;bis(4-methylaniline) (PubChem CID 142830870) has the molecular formula C34H38N4 and a molecular weight of 502.71 g/mol. Its IUPAC name is 4-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine;bis(4-methylaniline).
| Compound Name | 4-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine;bis(4-methylaniline) |
|---|---|
| PubChem CID | 142830870 |
| Molecular Formula | C34H38N4 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 4-N,4-N-bis(4-methylphenyl)benzene-1,4-diamine;bis(4-methylaniline) |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(N)cc2)cc1.Cc1ccc(N)cc1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C20H20N2.2C7H9N/c1-15-3-9-18(10-4-15)22(19-11-5-16(2)6-12-19)20-13-7-17(21)8-14-20;2*1-6-2-4-7(8)5-3-6/h3-14H,21H2,1-2H3;2*2-5H,8H2,1H3 |
| InChIKey | WSJMHVGJRFUGML-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|