C32H29N3 — CID 22013282
4-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]benzene-1,4-diamine (PubChem CID 22013282) has the molecular formula C32H29N3 and a molecular weight of 455.61 g/mol. Its IUPAC name is 4-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 22013282 |
| Molecular Formula | C32H29N3 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 4-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]benzene-1,4-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(Nc4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H29N3/c1-23-3-17-30(18-4-23)35(31-19-5-24(2)6-20-31)32-21-9-26(10-22-32)25-7-13-28(14-8-25)34-29-15-11-27(33)12-16-29/h3-22,34H,33H2,1-2H3 |
| InChIKey | QKSUDDRHVOKYHC-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|