C33H30N2 — CID 22013286
4-methyl-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]aniline (PubChem CID 22013286) has the molecular formula C33H30N2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 4-methyl-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]aniline.
| Compound Name | 4-methyl-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 22013286 |
| Molecular Formula | C33H30N2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 4-methyl-N-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]aniline |
| SMILES | Cc1ccc(Nc2ccc(-c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N2/c1-24-4-14-29(15-5-24)34-30-16-10-27(11-17-30)28-12-22-33(23-13-28)35(31-18-6-25(2)7-19-31)32-20-8-26(3)9-21-32/h4-23,34H,1-3H3 |
| InChIKey | BRJRVDAFUNFFCA-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |