C36H29N3 — CID 139760283
4-[4-(N-[4-(4-aminophenyl)phenyl]-4-phenylanilino)phenyl]aniline (PubChem CID 139760283) has the molecular formula C36H29N3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 4-[4-(N-[4-(4-aminophenyl)phenyl]-4-phenylanilino)phenyl]aniline.
| Compound Name | 4-[4-(N-[4-(4-aminophenyl)phenyl]-4-phenylanilino)phenyl]aniline |
|---|---|
| PubChem CID | 139760283 |
| Molecular Formula | C36H29N3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 4-[4-(N-[4-(4-aminophenyl)phenyl]-4-phenylanilino)phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H29N3/c37-32-16-6-27(7-17-32)30-12-22-35(23-13-30)39(34-20-10-29(11-21-34)26-4-2-1-3-5-26)36-24-14-31(15-25-36)28-8-18-33(38)19-9-28/h1-25H,37-38H2 |
| InChIKey | MGJOAAIILWUTJU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|