C24H24N4 — CID 67959062
benzene-1,4-diamine;4-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 67959062) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is benzene-1,4-diamine;4-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | benzene-1,4-diamine;4-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 67959062 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | benzene-1,4-diamine;4-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | Nc1ccc(N(c2ccccc2)c2ccccc2)cc1.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C18H16N2.C6H8N2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;7-5-1-2-6(8)4-3-5/h1-14H,19H2;1-4H,7-8H2 |
| InChIKey | JWLZLGFZYKUMJC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|