C40H38N6 — CID 178074679
4-N-(4-aminophenyl)-4-N-[4-[4-[4-(N-phenylanilino)phenyl]piperazin-1-yl]phenyl]benzene-1,4-diamine (PubChem CID 178074679) has the molecular formula C40H38N6 and a molecular weight of 602.79 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-[4-[4-[4-(N-phenylanilino)phenyl]piperazin-1-yl]phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-[4-[4-[4-(N-phenylanilino)phenyl]piperazin-1-yl]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 178074679 |
| Molecular Formula | C40H38N6 |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-[4-[4-[4-(N-phenylanilino)phenyl]piperazin-1-yl]phenyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N(c2ccc(N)cc2)c2ccc(N3CCN(c4ccc(N(c5ccccc5)c5ccccc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C40H38N6/c41-31-11-15-37(16-12-31)46(38-17-13-32(42)14-18-38)40-25-21-34(22-26-40)44-29-27-43(28-30-44)33-19-23-39(24-20-33)45(35-7-3-1-4-8-35)36-9-5-2-6-10-36/h1-26H,27-30,41-42H2 |
| InChIKey | HHWSMUJEGHVYFY-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 65.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|