C18H23N3 — CID 28809122
4-(4-benzyl-1,4-diazepan-1-yl)aniline (PubChem CID 28809122) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-(4-benzyl-1,4-diazepan-1-yl)aniline.
| Compound Name | 4-(4-benzyl-1,4-diazepan-1-yl)aniline |
|---|---|
| PubChem CID | 28809122 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-(4-benzyl-1,4-diazepan-1-yl)aniline |
| SMILES | Nc1ccc(N2CCCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3/c19-17-7-9-18(10-8-17)21-12-4-11-20(13-14-21)15-16-5-2-1-3-6-16/h1-3,5-10H,4,11-15,19H2 |
| InChIKey | UAZLXYDWZRYSNQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|