C17H21N3 — CID 22053417
1-benzyl-4-pyridin-3-yl-1,4-diazepane (PubChem CID 22053417) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-benzyl-4-pyridin-3-yl-1,4-diazepane.
| Compound Name | 1-benzyl-4-pyridin-3-yl-1,4-diazepane |
|---|---|
| PubChem CID | 22053417 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-benzyl-4-pyridin-3-yl-1,4-diazepane |
| SMILES | c1ccc(CN2CCCN(c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C17H21N3/c1-2-6-16(7-3-1)15-19-10-5-11-20(13-12-19)17-8-4-9-18-14-17/h1-4,6-9,14H,5,10-13,15H2 |
| InChIKey | KZNRJQVKHPDDHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |