C20H27N3 — CID 95718209
1-[(2R)-2-phenylpropyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane (PubChem CID 95718209) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-[(2R)-2-phenylpropyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane.
| Compound Name | 1-[(2R)-2-phenylpropyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 95718209 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-[(2R)-2-phenylpropyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane |
| SMILES | C[C@@H](CN1CCCN(Cc2cccnc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3/c1-18(20-8-3-2-4-9-20)16-22-11-6-12-23(14-13-22)17-19-7-5-10-21-15-19/h2-5,7-10,15,18H,6,11-14,16-17H2,1H3/t18-/m0/s1 |
| InChIKey | WZFQBRUEOPOGLR-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |