C22H26N4 — CID 95552633
3-[[4-[2-[(1R)-1-phenylethyl]imidazol-1-yl]piperidin-1-yl]methyl]pyridine (PubChem CID 95552633) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 3-[[4-[2-[(1R)-1-phenylethyl]imidazol-1-yl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 3-[[4-[2-[(1R)-1-phenylethyl]imidazol-1-yl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 95552633 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 3-[[4-[2-[(1R)-1-phenylethyl]imidazol-1-yl]piperidin-1-yl]methyl]pyridine |
| SMILES | C[C@H](c1ccccc1)c1nccn1C1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H26N4/c1-18(20-7-3-2-4-8-20)22-24-12-15-26(22)21-9-13-25(14-10-21)17-19-6-5-11-23-16-19/h2-8,11-12,15-16,18,21H,9-10,13-14,17H2,1H3/t18-/m1/s1 |
| InChIKey | RBEJIRJUAVBVPO-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |