C19H29N3O4 — CID 2912313
oxalic acid;1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]azepane (PubChem CID 2912313) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is oxalic acid;1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]azepane.
| Compound Name | oxalic acid;1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]azepane |
|---|---|
| PubChem CID | 2912313 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | oxalic acid;1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]azepane |
| SMILES | O=C(O)C(=O)O.c1cncc(CN2CCC(N3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C17H27N3.C2H2O4/c1-2-4-11-20(10-3-1)17-7-12-19(13-8-17)15-16-6-5-9-18-14-16;3-1(4)2(5)6/h5-6,9,14,17H,1-4,7-8,10-13,15H2;(H,3,4)(H,5,6) |
| InChIKey | UFBGKWZFFSXJBY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|