C24H38N4O — CID 96572438
(3S)-N-(cyclohexylmethyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 96572438) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is (3S)-N-(cyclohexylmethyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(cyclohexylmethyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 96572438 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (3S)-N-(cyclohexylmethyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1)[C@H]1CCCN(C2CCN(Cc3cccnc3)CC2)C1 |
| InChI | InChI=1S/C24H38N4O/c29-24(26-17-20-6-2-1-3-7-20)22-9-5-13-28(19-22)23-10-14-27(15-11-23)18-21-8-4-12-25-16-21/h4,8,12,16,20,22-23H,1-3,5-7,9-11,13-15,17-19H2,(H,26,29)/t22-/m0/s1 |
| InChIKey | KHPGMHBVZFAQEU-QFIPXVFZSA-N |
| XLogP | 3.45 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |