C24H38N4O — CID 96573815
azocan-1-yl-[(3R)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone (PubChem CID 96573815) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is azocan-1-yl-[(3R)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | azocan-1-yl-[(3R)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 96573815 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | azocan-1-yl-[(3R)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(C2CCN(Cc3cccnc3)CC2)C1)N1CCCCCCC1 |
| InChI | InChI=1S/C24H38N4O/c29-24(27-13-4-2-1-3-5-14-27)22-9-7-15-28(20-22)23-10-16-26(17-11-23)19-21-8-6-12-25-18-21/h6,8,12,18,22-23H,1-5,7,9-11,13-17,19-20H2/t22-/m1/s1 |
| InChIKey | NNARMSWJVHMLGQ-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |