C24H38N4O — CID 70776604
azocan-1-yl-[1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone (PubChem CID 70776604) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is azocan-1-yl-[1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | azocan-1-yl-[1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 70776604 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | azocan-1-yl-[1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(C2CCN(Cc3ccncc3)CC2)C1)N1CCCCCCC1 |
| InChI | InChI=1S/C24H38N4O/c29-24(27-14-4-2-1-3-5-15-27)22-7-6-16-28(20-22)23-10-17-26(18-11-23)19-21-8-12-25-13-9-21/h8-9,12-13,22-23H,1-7,10-11,14-20H2 |
| InChIKey | FMASRTJJGZVDFW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |