C26H39N3O5 — CID 90483690
azepan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone;oxalic acid (PubChem CID 90483690) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is azepan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone;oxalic acid.
| Compound Name | azepan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 90483690 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | azepan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone;oxalic acid |
| SMILES | O=C(C1CCCN(C2CCN(Cc3ccccc3)CC2)C1)N1CCCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H37N3O.C2H2O4/c28-24(26-14-6-1-2-7-15-26)22-11-8-16-27(20-22)23-12-17-25(18-13-23)19-21-9-4-3-5-10-21;3-1(4)2(5)6/h3-5,9-10,22-23H,1-2,6-8,11-20H2;(H,3,4)(H,5,6) |
| InChIKey | WCSWRKKEWZUPHQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|