C25H37N3O3 — CID 4657219
methyl 1-[1-(1-benzylpiperidin-4-yl)piperidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 4657219) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is methyl 1-[1-(1-benzylpiperidin-4-yl)piperidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[1-(1-benzylpiperidin-4-yl)piperidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4657219 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | methyl 1-[1-(1-benzylpiperidin-4-yl)piperidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)C2CCCN(C3CCN(Cc4ccccc4)CC3)C2)CC1 |
| InChI | InChI=1S/C25H37N3O3/c1-31-25(30)21-9-16-27(17-10-21)24(29)22-8-5-13-28(19-22)23-11-14-26(15-12-23)18-20-6-3-2-4-7-20/h2-4,6-7,21-23H,5,8-19H2,1H3 |
| InChIKey | JSLNPOMIOBKJMK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |