C25H39N3O — CID 45192001
azocan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone (PubChem CID 45192001) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is azocan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone.
| Compound Name | azocan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45192001 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | azocan-1-yl-[1-(1-benzylpiperidin-4-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(C2CCN(Cc3ccccc3)CC2)C1)N1CCCCCCC1 |
| InChI | InChI=1S/C25H39N3O/c29-25(27-15-7-2-1-3-8-16-27)23-12-9-17-28(21-23)24-13-18-26(19-14-24)20-22-10-5-4-6-11-22/h4-6,10-11,23-24H,1-3,7-9,12-21H2 |
| InChIKey | WCBJMZIHKIGWPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |