C25H40N4O — CID 96579465
azonan-1-yl-[(3S)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone (PubChem CID 96579465) has the molecular formula C25H40N4O and a molecular weight of 412.62 g/mol. Its IUPAC name is azonan-1-yl-[(3S)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | azonan-1-yl-[(3S)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 96579465 |
| Molecular Formula | C25H40N4O |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | azonan-1-yl-[(3S)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCCN(C2CCN(Cc3ccncc3)CC2)C1)N1CCCCCCCC1 |
| InChI | InChI=1S/C25H40N4O/c30-25(28-15-5-3-1-2-4-6-16-28)23-8-7-17-29(21-23)24-11-18-27(19-12-24)20-22-9-13-26-14-10-22/h9-10,13-14,23-24H,1-8,11-12,15-21H2/t23-/m0/s1 |
| InChIKey | KZRXBMFCSZOXLL-QHCPKHFHSA-N |
| XLogP | 3.94 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |