C15H23N3O4 — CID 2879902
oxalic acid;1-propan-2-yl-4-(pyridin-3-ylmethyl)piperazine (PubChem CID 2879902) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is oxalic acid;1-propan-2-yl-4-(pyridin-3-ylmethyl)piperazine.
| Compound Name | oxalic acid;1-propan-2-yl-4-(pyridin-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 2879902 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | oxalic acid;1-propan-2-yl-4-(pyridin-3-ylmethyl)piperazine |
| SMILES | CC(C)N1CCN(Cc2cccnc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H21N3.C2H2O4/c1-12(2)16-8-6-15(7-9-16)11-13-4-3-5-14-10-13;3-1(4)2(5)6/h3-5,10,12H,6-9,11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YMWCROBCLYEPRF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|