C19H23N3O2S — CID 97193072
(2R)-2-(2-methylsulfanylphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 97193072) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2R)-2-(2-methylsulfanylphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(2-methylsulfanylphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97193072 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2R)-2-(2-methylsulfanylphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | CSc1ccccc1[C@H](C(=O)O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c1-25-17-7-3-2-6-16(17)18(19(23)24)22-11-9-21(10-12-22)14-15-5-4-8-20-13-15/h2-8,13,18H,9-12,14H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | APHOMWXKLCJVIZ-GOSISDBHSA-N |
| XLogP | 2.75 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |