C19H22ClN3O3 — CID 97207767
(2R)-2-(5-chloro-2-methoxyphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 97207767) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-methoxyphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(5-chloro-2-methoxyphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97207767 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R)-2-(5-chloro-2-methoxyphenyl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc(Cl)cc1[C@H](C(=O)O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-26-17-5-4-15(20)11-16(17)18(19(24)25)23-9-7-22(8-10-23)13-14-3-2-6-21-12-14/h2-6,11-12,18H,7-10,13H2,1H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | MINHAVXZFDAGOP-GOSISDBHSA-N |
| XLogP | 2.69 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |