C18H21ClN4O2 — CID 113108510
N-(5-chloro-2-methoxyphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 113108510) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108510 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-25-17-5-4-15(19)11-16(17)21-18(24)23-9-7-22(8-10-23)13-14-3-2-6-20-12-14/h2-6,11-12H,7-10,13H2,1H3,(H,21,24) |
| InChIKey | AEFNLRWLROGBPX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |